C25H46O3Si2 — CID 134982897
(5R,6S,6aS)-5-[tert-butyl(dimethyl)silyl]oxy-6-[(Z,5S)-5-methoxyhept-2-enyl]-3-trimethylsilyl-4,5,6,6a-tetrahydro-1H-pentalen-2-one (PubChem CID 134982897) has the molecular formula C25H46O3Si2 and a molecular weight of 450.81 g/mol. Its IUPAC name is (5R,6S,6aS)-5-[tert-butyl(dimethyl)silyl]oxy-6-[(Z,5S)-5-methoxyhept-2-enyl]-3-trimethylsilyl-4,5,6,6a-tetrahydro-1H-pentalen-2-one.
| Compound Name | (5R,6S,6aS)-5-[tert-butyl(dimethyl)silyl]oxy-6-[(Z,5S)-5-methoxyhept-2-enyl]-3-trimethylsilyl-4,5,6,6a-tetrahydro-1H-pentalen-2-one |
|---|---|
| PubChem CID | 134982897 |
| Molecular Formula | C25H46O3Si2 |
| Molecular Weight | 450.81 g/mol |
| Exact Mass | 450.30 |
| IUPAC Name | (5R,6S,6aS)-5-[tert-butyl(dimethyl)silyl]oxy-6-[(Z,5S)-5-methoxyhept-2-enyl]-3-trimethylsilyl-4,5,6,6a-tetrahydro-1H-pentalen-2-one |
| SMILES | CC[C@@H](C/C=C\C[C@H]1[C@@H]2CC(=O)C([Si](C)(C)C)=C2C[C@H]1O[Si](C)(C)C(C)(C)C)OC |
| InChI | InChI=1S/C25H46O3Si2/c1-11-18(27-5)14-12-13-15-19-20-16-22(26)24(29(6,7)8)21(20)17-23(19)28-30(9,10)25(2,3)4/h12-13,18-20,23H,11,14-17H2,1-10H3/b13-12-/t18-,19-,20-,23+/m0/s1 |
| InChIKey | TUEUHKWIEGHKNK-RXDYFVBXSA-N |
| XLogP | 6.92 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 450.81 |
| LogP ≤ 5 | 6.92 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|