C22H36O2Si — CID 166445994
(7R,9R,10R,11S)-9-[tert-butyl(dimethyl)silyl]oxy-10,14-dimethyltricyclo[9.3.0.03,7]tetradeca-1(14),3-dien-5-one (PubChem CID 166445994) has the molecular formula C22H36O2Si and a molecular weight of 360.61 g/mol. Its IUPAC name is (7R,9R,10R,11S)-9-[tert-butyl(dimethyl)silyl]oxy-10,14-dimethyltricyclo[9.3.0.03,7]tetradeca-1(14),3-dien-5-one.
| Compound Name | (7R,9R,10R,11S)-9-[tert-butyl(dimethyl)silyl]oxy-10,14-dimethyltricyclo[9.3.0.03,7]tetradeca-1(14),3-dien-5-one |
|---|---|
| PubChem CID | 166445994 |
| Molecular Formula | C22H36O2Si |
| Molecular Weight | 360.61 g/mol |
| Exact Mass | 360.25 |
| IUPAC Name | (7R,9R,10R,11S)-9-[tert-butyl(dimethyl)silyl]oxy-10,14-dimethyltricyclo[9.3.0.03,7]tetradeca-1(14),3-dien-5-one |
| SMILES | CC1=C2CC3=CC(=O)C[C@H]3C[C@@H](O[Si](C)(C)C(C)(C)C)[C@H](C)[C@@H]2CC1 |
| InChI | InChI=1S/C22H36O2Si/c1-14-8-9-19-15(2)21(24-25(6,7)22(3,4)5)13-17-11-18(23)10-16(17)12-20(14)19/h10,15,17,19,21H,8-9,11-13H2,1-7H3/t15-,17+,19+,21-/m1/s1 |
| InChIKey | KIUSUHNITGTVQX-ZWVMGRIOSA-N |
| XLogP | 6.05 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 25 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 360.61 |
| LogP ≤ 5 | 6.05 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|