C18H30O2Si — CID 53348302
(1R,7R,10R,11R)-10-[tert-butyl(dimethyl)silyl]oxytricyclo[5.3.2.04,11]dodec-4-en-6-one (PubChem CID 53348302) has the molecular formula C18H30O2Si and a molecular weight of 306.52 g/mol. Its IUPAC name is (1R,7R,10R,11R)-10-[tert-butyl(dimethyl)silyl]oxytricyclo[5.3.2.04,11]dodec-4-en-6-one.
| Compound Name | (1R,7R,10R,11R)-10-[tert-butyl(dimethyl)silyl]oxytricyclo[5.3.2.04,11]dodec-4-en-6-one |
|---|---|
| PubChem CID | 53348302 |
| Molecular Formula | C18H30O2Si |
| Molecular Weight | 306.52 g/mol |
| Exact Mass | 306.20 |
| IUPAC Name | (1R,7R,10R,11R)-10-[tert-butyl(dimethyl)silyl]oxytricyclo[5.3.2.04,11]dodec-4-en-6-one |
| SMILES | CC(C)(C)[Si](C)(C)O[C@@H]1CC[C@@H]2C[C@H]3C(=CC2=O)CC[C@@H]13 |
| InChI | InChI=1S/C18H30O2Si/c1-18(2,3)21(4,5)20-17-9-7-13-10-15-12(11-16(13)19)6-8-14(15)17/h11,13-15,17H,6-10H2,1-5H3/t13-,14-,15+,17-/m1/s1 |
| InChIKey | BDEVGCFYLXWROL-PNBKFKSVSA-N |
| XLogP | 4.71 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 306.52 |
| LogP ≤ 5 | 4.71 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|