C19H30O2Si — CID 135023379
1-[tert-butyl(dimethyl)silyl]oxy-1,2,3,3a,4,6,7,8-octahydrocyclopenta[g]azulen-5-one (PubChem CID 135023379) has the molecular formula C19H30O2Si and a molecular weight of 318.53 g/mol. Its IUPAC name is 1-[tert-butyl(dimethyl)silyl]oxy-1,2,3,3a,4,6,7,8-octahydrocyclopenta[g]azulen-5-one.
| Compound Name | 1-[tert-butyl(dimethyl)silyl]oxy-1,2,3,3a,4,6,7,8-octahydrocyclopenta[g]azulen-5-one |
|---|---|
| PubChem CID | 135023379 |
| Molecular Formula | C19H30O2Si |
| Molecular Weight | 318.53 g/mol |
| Exact Mass | 318.20 |
| IUPAC Name | 1-[tert-butyl(dimethyl)silyl]oxy-1,2,3,3a,4,6,7,8-octahydrocyclopenta[g]azulen-5-one |
| SMILES | CC(C)(C)[Si](C)(C)OC1CCC2CC(=O)C3=C(C=C21)CCC3 |
| InChI | InChI=1S/C19H30O2Si/c1-19(2,3)22(4,5)21-18-10-9-14-12-17(20)15-8-6-7-13(15)11-16(14)18/h11,14,18H,6-10,12H2,1-5H3 |
| InChIKey | AWGBQAKFJVDVFV-UHFFFAOYSA-N |
| XLogP | 5.17 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 22 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 318.53 |
| LogP ≤ 5 | 5.17 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|