C21H34O2Si — CID 10593724
(1S,7S,9Z,11S,14S)-14-[tert-butyl(dimethyl)silyl]oxy-10-methyltricyclo[9.3.0.03,7]tetradeca-3,9-dien-5-one (PubChem CID 10593724) has the molecular formula C21H34O2Si and a molecular weight of 346.59 g/mol. Its IUPAC name is (1S,7S,9Z,11S,14S)-14-[tert-butyl(dimethyl)silyl]oxy-10-methyltricyclo[9.3.0.03,7]tetradeca-3,9-dien-5-one.
| Compound Name | (1S,7S,9Z,11S,14S)-14-[tert-butyl(dimethyl)silyl]oxy-10-methyltricyclo[9.3.0.03,7]tetradeca-3,9-dien-5-one |
|---|---|
| PubChem CID | 10593724 |
| Molecular Formula | C21H34O2Si |
| Molecular Weight | 346.59 g/mol |
| Exact Mass | 346.23 |
| IUPAC Name | (1S,7S,9Z,11S,14S)-14-[tert-butyl(dimethyl)silyl]oxy-10-methyltricyclo[9.3.0.03,7]tetradeca-3,9-dien-5-one |
| SMILES | C/C1=C/C[C@H]2CC(=O)C=C2C[C@@H]2[C@@H](O[Si](C)(C)C(C)(C)C)CC[C@H]12 |
| InChI | InChI=1S/C21H34O2Si/c1-14-7-8-15-11-17(22)12-16(15)13-19-18(14)9-10-20(19)23-24(5,6)21(2,3)4/h7,12,15,18-20H,8-11,13H2,1-6H3/b14-7-/t15-,18+,19-,20-/m0/s1 |
| InChIKey | JKFSESQVDXSSNZ-HBHZWSPASA-N |
| XLogP | 5.66 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 24 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 346.59 |
| LogP ≤ 5 | 5.66 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|