C17H26O3Si — CID 134864208
(6S,9S)-9-[tert-butyl(dimethyl)silyl]oxybicyclo[4.4.1]undeca-1,4-diene-3,11-dione (PubChem CID 134864208) has the molecular formula C17H26O3Si and a molecular weight of 306.48 g/mol. Its IUPAC name is (6S,9S)-9-[tert-butyl(dimethyl)silyl]oxybicyclo[4.4.1]undeca-1,4-diene-3,11-dione.
| Compound Name | (6S,9S)-9-[tert-butyl(dimethyl)silyl]oxybicyclo[4.4.1]undeca-1,4-diene-3,11-dione |
|---|---|
| PubChem CID | 134864208 |
| Molecular Formula | C17H26O3Si |
| Molecular Weight | 306.48 g/mol |
| Exact Mass | 306.17 |
| IUPAC Name | (6S,9S)-9-[tert-butyl(dimethyl)silyl]oxybicyclo[4.4.1]undeca-1,4-diene-3,11-dione |
| SMILES | CC(C)(C)[Si](C)(C)O[C@H]1CC[C@H]2C=CC(=O)C=C(C1)C2=O |
| InChI | InChI=1S/C17H26O3Si/c1-17(2,3)21(4,5)20-15-9-7-12-6-8-14(18)10-13(11-15)16(12)19/h6,8,10,12,15H,7,9,11H2,1-5H3/t12-,15+/m1/s1 |
| InChIKey | NNBFZWKAYJTRTH-DOMZBBRYSA-N |
| XLogP | 3.81 |
| TPSA | 43.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 306.48 |
| LogP ≤ 5 | 3.81 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|