C24H42O3Si — CID 135068870
9-[2-[tert-butyl(dimethyl)silyl]oxyethyl]-8-hexylbicyclo[4.3.1]dec-6-ene-2,10-dione (PubChem CID 135068870) has the molecular formula C24H42O3Si and a molecular weight of 406.68 g/mol. Its IUPAC name is 9-[2-[tert-butyl(dimethyl)silyl]oxyethyl]-8-hexylbicyclo[4.3.1]dec-6-ene-2,10-dione.
| Compound Name | 9-[2-[tert-butyl(dimethyl)silyl]oxyethyl]-8-hexylbicyclo[4.3.1]dec-6-ene-2,10-dione |
|---|---|
| PubChem CID | 135068870 |
| Molecular Formula | C24H42O3Si |
| Molecular Weight | 406.68 g/mol |
| Exact Mass | 406.29 |
| IUPAC Name | 9-[2-[tert-butyl(dimethyl)silyl]oxyethyl]-8-hexylbicyclo[4.3.1]dec-6-ene-2,10-dione |
| SMILES | CCCCCCC1C=C2CCCC(=O)C(C2=O)C1CCO[Si](C)(C)C(C)(C)C |
| InChI | InChI=1S/C24H42O3Si/c1-7-8-9-10-12-18-17-19-13-11-14-21(25)22(23(19)26)20(18)15-16-27-28(5,6)24(2,3)4/h17-18,20,22H,7-16H2,1-6H3 |
| InChIKey | NUTAZJYNXKMPSU-UHFFFAOYSA-N |
| XLogP | 6.48 |
| TPSA | 43.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 406.68 |
| LogP ≤ 5 | 6.48 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|