C19H34O3Si2 — CID 134886572
2-[(1S,2R,6aS)-2-[tert-butyl(dimethyl)silyl]oxy-5-oxo-4-trimethylsilyl-2,3,6,6a-tetrahydro-1H-pentalen-1-yl]acetaldehyde (PubChem CID 134886572) has the molecular formula C19H34O3Si2 and a molecular weight of 366.65 g/mol. Its IUPAC name is 2-[(1S,2R,6aS)-2-[tert-butyl(dimethyl)silyl]oxy-5-oxo-4-trimethylsilyl-2,3,6,6a-tetrahydro-1H-pentalen-1-yl]acetaldehyde.
| Compound Name | 2-[(1S,2R,6aS)-2-[tert-butyl(dimethyl)silyl]oxy-5-oxo-4-trimethylsilyl-2,3,6,6a-tetrahydro-1H-pentalen-1-yl]acetaldehyde |
|---|---|
| PubChem CID | 134886572 |
| Molecular Formula | C19H34O3Si2 |
| Molecular Weight | 366.65 g/mol |
| Exact Mass | 366.20 |
| IUPAC Name | 2-[(1S,2R,6aS)-2-[tert-butyl(dimethyl)silyl]oxy-5-oxo-4-trimethylsilyl-2,3,6,6a-tetrahydro-1H-pentalen-1-yl]acetaldehyde |
| SMILES | CC(C)(C)[Si](C)(C)O[C@@H]1CC2=C([Si](C)(C)C)C(=O)C[C@H]2[C@@H]1CC=O |
| InChI | InChI=1S/C19H34O3Si2/c1-19(2,3)24(7,8)22-17-12-15-14(13(17)9-10-20)11-16(21)18(15)23(4,5)6/h10,13-14,17H,9,11-12H2,1-8H3/t13-,14-,17+/m0/s1 |
| InChIKey | RBWCULVYJUSVDL-GRDNDAEWSA-N |
| XLogP | 4.75 |
| TPSA | 43.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 366.65 |
| LogP ≤ 5 | 4.75 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|