C31H58O2Si2 — CID 56980203
(3aS,4S,5R,6aS)-4-[(3S,5R)-3-[tert-butyl(dimethyl)silyl]-5-methylnon-1-enyl]-5-[tert-butyl(dimethyl)silyl]oxy-2-methylidene-3,3a,4,5,6,6a-hexahydropentalen-1-one (PubChem CID 56980203) has the molecular formula C31H58O2Si2 and a molecular weight of 518.98 g/mol. Its IUPAC name is (3aS,4S,5R,6aS)-4-[(3S,5R)-3-[tert-butyl(dimethyl)silyl]-5-methylnon-1-enyl]-5-[tert-butyl(dimethyl)silyl]oxy-2-methylidene-3,3a,4,5,6,6a-hexahydropentalen-1-one.
| Compound Name | (3aS,4S,5R,6aS)-4-[(3S,5R)-3-[tert-butyl(dimethyl)silyl]-5-methylnon-1-enyl]-5-[tert-butyl(dimethyl)silyl]oxy-2-methylidene-3,3a,4,5,6,6a-hexahydropentalen-1-one |
|---|---|
| PubChem CID | 56980203 |
| Molecular Formula | C31H58O2Si2 |
| Molecular Weight | 518.98 g/mol |
| Exact Mass | 518.40 |
| IUPAC Name | (3aS,4S,5R,6aS)-4-[(3S,5R)-3-[tert-butyl(dimethyl)silyl]-5-methylnon-1-enyl]-5-[tert-butyl(dimethyl)silyl]oxy-2-methylidene-3,3a,4,5,6,6a-hexahydropentalen-1-one |
| SMILES | C=C1C[C@H]2[C@H](C=C[C@H](C[C@H](C)CCCC)[Si](C)(C)C(C)(C)C)[C@H](O[Si](C)(C)C(C)(C)C)C[C@@H]2C1=O |
| InChI | InChI=1S/C31H58O2Si2/c1-14-15-16-22(2)19-24(34(10,11)30(4,5)6)17-18-25-26-20-23(3)29(32)27(26)21-28(25)33-35(12,13)31(7,8)9/h17-18,22,24-28H,3,14-16,19-21H2,1-2,4-13H3/t22-,24-,25+,26+,27+,28-/m1/s1 |
| InChIKey | RKMAIIVXAHNKQJ-WQVNUOIJSA-N |
| XLogP | 9.81 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 35 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 518.98 |
| LogP ≤ 5 | 9.81 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|