C18H28O3Si — CID 10925261
(1S,3aR,5aS,9aS)-1-[tert-butyl(dimethyl)silyl]oxy-2,3,3a,5,5a,6-hexahydro-1H-cyclopenta[i]indene-4,7-dione (PubChem CID 10925261) has the molecular formula C18H28O3Si and a molecular weight of 320.51 g/mol. Its IUPAC name is (1S,3aR,5aS,9aS)-1-[tert-butyl(dimethyl)silyl]oxy-2,3,3a,5,5a,6-hexahydro-1H-cyclopenta[i]indene-4,7-dione.
| Compound Name | (1S,3aR,5aS,9aS)-1-[tert-butyl(dimethyl)silyl]oxy-2,3,3a,5,5a,6-hexahydro-1H-cyclopenta[i]indene-4,7-dione |
|---|---|
| PubChem CID | 10925261 |
| Molecular Formula | C18H28O3Si |
| Molecular Weight | 320.51 g/mol |
| Exact Mass | 320.18 |
| IUPAC Name | (1S,3aR,5aS,9aS)-1-[tert-butyl(dimethyl)silyl]oxy-2,3,3a,5,5a,6-hexahydro-1H-cyclopenta[i]indene-4,7-dione |
| SMILES | CC(C)(C)[Si](C)(C)O[C@H]1CC[C@H]2C(=O)C[C@@H]3CC(=O)C=C[C@]312 |
| InChI | InChI=1S/C18H28O3Si/c1-17(2,3)22(4,5)21-16-7-6-14-15(20)11-12-10-13(19)8-9-18(12,14)16/h8-9,12,14,16H,6-7,10-11H2,1-5H3/t12-,14-,16-,18+/m0/s1 |
| InChIKey | LXFRDHXGMNANHI-WIRVQXDCSA-N |
| XLogP | 3.89 |
| TPSA | 43.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 320.51 |
| LogP ≤ 5 | 3.89 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|