C19H30O2Si — CID 134831967
(6R)-6-ethyl-6-triethylsilyloxytricyclo[6.2.1.02,7]undeca-4,9-dien-3-one (PubChem CID 134831967) has the molecular formula C19H30O2Si and a molecular weight of 318.53 g/mol. Its IUPAC name is (6R)-6-ethyl-6-triethylsilyloxytricyclo[6.2.1.02,7]undeca-4,9-dien-3-one.
| Compound Name | (6R)-6-ethyl-6-triethylsilyloxytricyclo[6.2.1.02,7]undeca-4,9-dien-3-one |
|---|---|
| PubChem CID | 134831967 |
| Molecular Formula | C19H30O2Si |
| Molecular Weight | 318.53 g/mol |
| Exact Mass | 318.20 |
| IUPAC Name | (6R)-6-ethyl-6-triethylsilyloxytricyclo[6.2.1.02,7]undeca-4,9-dien-3-one |
| SMILES | CCC1(O[Si](CC)(CC)CC)C=CC(=O)C2C3C=CC(C3)C21 |
| InChI | InChI=1S/C19H30O2Si/c1-5-19(21-22(6-2,7-3)8-4)12-11-16(20)17-14-9-10-15(13-14)18(17)19/h9-12,14-15,17-18H,5-8,13H2,1-4H3 |
| InChIKey | SLTZSGDMMJSIEW-UHFFFAOYSA-N |
| XLogP | 4.73 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 318.53 |
| LogP ≤ 5 | 4.73 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|