C19H30O2Si — CID 139252599
(3aS,9aS,9bS)-5-[tert-butyl(dimethyl)silyl]oxy-3a,4,6,7,8,9,9a,9b-octahydrocyclopenta[a]naphthalen-3-one (PubChem CID 139252599) has the molecular formula C19H30O2Si and a molecular weight of 318.53 g/mol. Its IUPAC name is (3aS,9aS,9bS)-5-[tert-butyl(dimethyl)silyl]oxy-3a,4,6,7,8,9,9a,9b-octahydrocyclopenta[a]naphthalen-3-one.
| Compound Name | (3aS,9aS,9bS)-5-[tert-butyl(dimethyl)silyl]oxy-3a,4,6,7,8,9,9a,9b-octahydrocyclopenta[a]naphthalen-3-one |
|---|---|
| PubChem CID | 139252599 |
| Molecular Formula | C19H30O2Si |
| Molecular Weight | 318.53 g/mol |
| Exact Mass | 318.20 |
| IUPAC Name | (3aS,9aS,9bS)-5-[tert-butyl(dimethyl)silyl]oxy-3a,4,6,7,8,9,9a,9b-octahydrocyclopenta[a]naphthalen-3-one |
| SMILES | CC(C)(C)[Si](C)(C)OC1=C2CCCC[C@H]2[C@@H]2C=CC(=O)[C@H]2C1 |
| InChI | InChI=1S/C19H30O2Si/c1-19(2,3)22(4,5)21-18-12-16-14(10-11-17(16)20)13-8-6-7-9-15(13)18/h10-11,13-14,16H,6-9,12H2,1-5H3/t13-,14-,16-/m0/s1 |
| InChIKey | DUCLKBDIGFEFAR-DZKIICNBSA-N |
| XLogP | 5.23 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 22 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 318.53 |
| LogP ≤ 5 | 5.23 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|