C25H40O2Si — CID 91744762
17-[tert-butyl(dimethyl)silyl]oxy-13-ethyl-2,6,7,8,9,10,11,12,14,15-decahydro-1H-cyclopenta[a]phenanthren-3-one (PubChem CID 91744762) has the molecular formula C25H40O2Si and a molecular weight of 400.68 g/mol. Its IUPAC name is 17-[tert-butyl(dimethyl)silyl]oxy-13-ethyl-2,6,7,8,9,10,11,12,14,15-decahydro-1H-cyclopenta[a]phenanthren-3-one.
| Compound Name | 17-[tert-butyl(dimethyl)silyl]oxy-13-ethyl-2,6,7,8,9,10,11,12,14,15-decahydro-1H-cyclopenta[a]phenanthren-3-one |
|---|---|
| PubChem CID | 91744762 |
| Molecular Formula | C25H40O2Si |
| Molecular Weight | 400.68 g/mol |
| Exact Mass | 400.28 |
| IUPAC Name | 17-[tert-butyl(dimethyl)silyl]oxy-13-ethyl-2,6,7,8,9,10,11,12,14,15-decahydro-1H-cyclopenta[a]phenanthren-3-one |
| SMILES | CCC12CCC3C4CCC(=O)C=C4CCC3C1CC=C2O[Si](C)(C)C(C)(C)C |
| InChI | InChI=1S/C25H40O2Si/c1-7-25-15-14-20-19-11-9-18(26)16-17(19)8-10-21(20)22(25)12-13-23(25)27-28(5,6)24(2,3)4/h13,16,19-22H,7-12,14-15H2,1-6H3 |
| InChIKey | UJBPIZHCZIVPCN-UHFFFAOYSA-N |
| XLogP | 7.03 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 400.68 |
| LogP ≤ 5 | 7.03 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|