C24H40O2Si — CID 10971140
(4aR,4bS,8aR,10aR)-7-[tert-butyl(dimethyl)silyl]oxy-2,4b,8,10a-tetramethyl-4a,5,6,8a,9,10-hexahydro-4H-phenanthren-1-one (PubChem CID 10971140) has the molecular formula C24H40O2Si and a molecular weight of 388.67 g/mol. Its IUPAC name is (4aR,4bS,8aR,10aR)-7-[tert-butyl(dimethyl)silyl]oxy-2,4b,8,10a-tetramethyl-4a,5,6,8a,9,10-hexahydro-4H-phenanthren-1-one.
| Compound Name | (4aR,4bS,8aR,10aR)-7-[tert-butyl(dimethyl)silyl]oxy-2,4b,8,10a-tetramethyl-4a,5,6,8a,9,10-hexahydro-4H-phenanthren-1-one |
|---|---|
| PubChem CID | 10971140 |
| Molecular Formula | C24H40O2Si |
| Molecular Weight | 388.67 g/mol |
| Exact Mass | 388.28 |
| IUPAC Name | (4aR,4bS,8aR,10aR)-7-[tert-butyl(dimethyl)silyl]oxy-2,4b,8,10a-tetramethyl-4a,5,6,8a,9,10-hexahydro-4H-phenanthren-1-one |
| SMILES | CC1=CC[C@@H]2[C@@]3(C)CCC(O[Si](C)(C)C(C)(C)C)=C(C)[C@@H]3CC[C@@]2(C)C1=O |
| InChI | InChI=1S/C24H40O2Si/c1-16-10-11-20-23(6)15-13-19(26-27(8,9)22(3,4)5)17(2)18(23)12-14-24(20,7)21(16)25/h10,18,20H,11-15H2,1-9H3/t18-,20+,23-,24+/m0/s1 |
| InChIKey | ABEVIAWTQRWUNE-GONLTWLXSA-N |
| XLogP | 7.03 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 388.67 |
| LogP ≤ 5 | 7.03 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|