C24H42O2Si — CID 53348336
(4aR,5R,6S,8S,8aR)-8-[tert-butyl(dimethyl)silyl]oxy-3,4a,6-trimethyl-5-(3-methylbut-2-enyl)-1,5,6,7,8,8a-hexahydronaphthalen-2-one (PubChem CID 53348336) has the molecular formula C24H42O2Si and a molecular weight of 390.68 g/mol. Its IUPAC name is (4aR,5R,6S,8S,8aR)-8-[tert-butyl(dimethyl)silyl]oxy-3,4a,6-trimethyl-5-(3-methylbut-2-enyl)-1,5,6,7,8,8a-hexahydronaphthalen-2-one.
| Compound Name | (4aR,5R,6S,8S,8aR)-8-[tert-butyl(dimethyl)silyl]oxy-3,4a,6-trimethyl-5-(3-methylbut-2-enyl)-1,5,6,7,8,8a-hexahydronaphthalen-2-one |
|---|---|
| PubChem CID | 53348336 |
| Molecular Formula | C24H42O2Si |
| Molecular Weight | 390.68 g/mol |
| Exact Mass | 390.30 |
| IUPAC Name | (4aR,5R,6S,8S,8aR)-8-[tert-butyl(dimethyl)silyl]oxy-3,4a,6-trimethyl-5-(3-methylbut-2-enyl)-1,5,6,7,8,8a-hexahydronaphthalen-2-one |
| SMILES | CC(C)=CC[C@@H]1[C@@H](C)C[C@H](O[Si](C)(C)C(C)(C)C)[C@@H]2CC(=O)C(C)=C[C@@]12C |
| InChI | InChI=1S/C24H42O2Si/c1-16(2)11-12-19-17(3)13-22(26-27(9,10)23(5,6)7)20-14-21(25)18(4)15-24(19,20)8/h11,15,17,19-20,22H,12-14H2,1-10H3/t17-,19+,20-,22-,24-/m0/s1 |
| InChIKey | FOLHGDNPYKBQSZ-GVNIMWCESA-N |
| XLogP | 6.93 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 390.68 |
| LogP ≤ 5 | 6.93 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|