C27H46O2Si — CID 53348338
(3S,4R,4aR,5R,6S,8S,8aR)-8-[tert-butyl(dimethyl)silyl]oxy-3,4a,6-trimethyl-5-(3-methylbut-2-enyl)-4-prop-1-ynyl-1,3,4,5,6,7,8,8a-octahydronaphthalen-2-one (PubChem CID 53348338) has the molecular formula C27H46O2Si and a molecular weight of 430.75 g/mol. Its IUPAC name is (3S,4R,4aR,5R,6S,8S,8aR)-8-[tert-butyl(dimethyl)silyl]oxy-3,4a,6-trimethyl-5-(3-methylbut-2-enyl)-4-prop-1-ynyl-1,3,4,5,6,7,8,8a-octahydronaphthalen-2-one.
| Compound Name | (3S,4R,4aR,5R,6S,8S,8aR)-8-[tert-butyl(dimethyl)silyl]oxy-3,4a,6-trimethyl-5-(3-methylbut-2-enyl)-4-prop-1-ynyl-1,3,4,5,6,7,8,8a-octahydronaphthalen-2-one |
|---|---|
| PubChem CID | 53348338 |
| Molecular Formula | C27H46O2Si |
| Molecular Weight | 430.75 g/mol |
| Exact Mass | 430.33 |
| IUPAC Name | (3S,4R,4aR,5R,6S,8S,8aR)-8-[tert-butyl(dimethyl)silyl]oxy-3,4a,6-trimethyl-5-(3-methylbut-2-enyl)-4-prop-1-ynyl-1,3,4,5,6,7,8,8a-octahydronaphthalen-2-one |
| SMILES | CC#C[C@@H]1[C@H](C)C(=O)C[C@H]2[C@@H](O[Si](C)(C)C(C)(C)C)C[C@H](C)[C@@H](CC=C(C)C)[C@]12C |
| InChI | InChI=1S/C27H46O2Si/c1-12-13-22-20(5)24(28)17-23-25(29-30(10,11)26(6,7)8)16-19(4)21(27(22,23)9)15-14-18(2)3/h14,19-23,25H,15-17H2,1-11H3/t19-,20-,21+,22+,23-,25-,27+/m0/s1 |
| InChIKey | DXXWONVVJDYIAP-UCHBVNFESA-N |
| XLogP | 7.26 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 430.75 |
| LogP ≤ 5 | 7.26 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|