C25H44O2Si — CID 134901647
(2R,5R)-5-[tert-butyl(dimethyl)silyl]oxy-2-ethyl-2,8,8-trimethyl-3,4a,4b,5,6,7,10,10a-octahydro-1H-phenanthren-4-one (PubChem CID 134901647) has the molecular formula C25H44O2Si and a molecular weight of 404.71 g/mol. Its IUPAC name is (2R,5R)-5-[tert-butyl(dimethyl)silyl]oxy-2-ethyl-2,8,8-trimethyl-3,4a,4b,5,6,7,10,10a-octahydro-1H-phenanthren-4-one.
| Compound Name | (2R,5R)-5-[tert-butyl(dimethyl)silyl]oxy-2-ethyl-2,8,8-trimethyl-3,4a,4b,5,6,7,10,10a-octahydro-1H-phenanthren-4-one |
|---|---|
| PubChem CID | 134901647 |
| Molecular Formula | C25H44O2Si |
| Molecular Weight | 404.71 g/mol |
| Exact Mass | 404.31 |
| IUPAC Name | (2R,5R)-5-[tert-butyl(dimethyl)silyl]oxy-2-ethyl-2,8,8-trimethyl-3,4a,4b,5,6,7,10,10a-octahydro-1H-phenanthren-4-one |
| SMILES | CC[C@@]1(C)CC(=O)C2C(CC=C3C2[C@H](O[Si](C)(C)C(C)(C)C)CCC3(C)C)C1 |
| InChI | InChI=1S/C25H44O2Si/c1-10-25(7)15-17-11-12-18-22(21(17)19(26)16-25)20(13-14-24(18,5)6)27-28(8,9)23(2,3)4/h12,17,20-22H,10-11,13-16H2,1-9H3/t17?,20-,21?,22?,25-/m1/s1 |
| InChIKey | PDXAHNYZDRNWOD-SVHBALEWSA-N |
| XLogP | 7.15 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 404.71 |
| LogP ≤ 5 | 7.15 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|