C29H52O3Si — CID 72958846
methyl 3-[6-[tert-butyl(dimethyl)silyl]oxy-5,8a-dimethyl-2-methylidene-5-(4-methylpent-3-enyl)-3,4,4a,6,7,8-hexahydro-1H-naphthalen-1-yl]propanoate (PubChem CID 72958846) has the molecular formula C29H52O3Si and a molecular weight of 476.82 g/mol. Its IUPAC name is methyl 3-[6-[tert-butyl(dimethyl)silyl]oxy-5,8a-dimethyl-2-methylidene-5-(4-methylpent-3-enyl)-3,4,4a,6,7,8-hexahydro-1H-naphthalen-1-yl]propanoate.
| Compound Name | methyl 3-[6-[tert-butyl(dimethyl)silyl]oxy-5,8a-dimethyl-2-methylidene-5-(4-methylpent-3-enyl)-3,4,4a,6,7,8-hexahydro-1H-naphthalen-1-yl]propanoate |
|---|---|
| PubChem CID | 72958846 |
| Molecular Formula | C29H52O3Si |
| Molecular Weight | 476.82 g/mol |
| Exact Mass | 476.37 |
| IUPAC Name | methyl 3-[6-[tert-butyl(dimethyl)silyl]oxy-5,8a-dimethyl-2-methylidene-5-(4-methylpent-3-enyl)-3,4,4a,6,7,8-hexahydro-1H-naphthalen-1-yl]propanoate |
| SMILES | C=C1CCC2C(C)(CCC=C(C)C)C(O[Si](C)(C)C(C)(C)C)CCC2(C)C1CCC(=O)OC |
| InChI | InChI=1S/C29H52O3Si/c1-21(2)13-12-19-29(8)24-16-14-22(3)23(15-17-26(30)31-9)28(24,7)20-18-25(29)32-33(10,11)27(4,5)6/h13,23-25H,3,12,14-20H2,1-2,4-11H3 |
| InChIKey | BGVKWTOWYFGZSY-UHFFFAOYSA-N |
| XLogP | 8.47 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 476.82 |
| LogP ≤ 5 | 8.47 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|