C26H46O2Si — CID 134865395
(4S)-4-[2-[(1S,2S,4S,5S)-4-[tert-butyl(dimethyl)silyl]oxy-2,6,6-trimethyl-2-bicyclo[3.1.1]heptanyl]ethyl]-2,4-dimethylcyclohex-2-en-1-one (PubChem CID 134865395) has the molecular formula C26H46O2Si and a molecular weight of 418.74 g/mol. Its IUPAC name is (4S)-4-[2-[(1S,2S,4S,5S)-4-[tert-butyl(dimethyl)silyl]oxy-2,6,6-trimethyl-2-bicyclo[3.1.1]heptanyl]ethyl]-2,4-dimethylcyclohex-2-en-1-one.
| Compound Name | (4S)-4-[2-[(1S,2S,4S,5S)-4-[tert-butyl(dimethyl)silyl]oxy-2,6,6-trimethyl-2-bicyclo[3.1.1]heptanyl]ethyl]-2,4-dimethylcyclohex-2-en-1-one |
|---|---|
| PubChem CID | 134865395 |
| Molecular Formula | C26H46O2Si |
| Molecular Weight | 418.74 g/mol |
| Exact Mass | 418.33 |
| IUPAC Name | (4S)-4-[2-[(1S,2S,4S,5S)-4-[tert-butyl(dimethyl)silyl]oxy-2,6,6-trimethyl-2-bicyclo[3.1.1]heptanyl]ethyl]-2,4-dimethylcyclohex-2-en-1-one |
| SMILES | CC1=C[C@@](C)(CC[C@@]2(C)C[C@H](O[Si](C)(C)C(C)(C)C)[C@H]3C[C@@H]2C3(C)C)CCC1=O |
| InChI | InChI=1S/C26H46O2Si/c1-18-16-25(7,12-11-20(18)27)13-14-26(8)17-21(19-15-22(26)24(19,5)6)28-29(9,10)23(2,3)4/h16,19,21-22H,11-15,17H2,1-10H3/t19-,21+,22-,25-,26+/m1/s1 |
| InChIKey | CZSMQWSKPMUEQC-GMKCPMMGSA-N |
| XLogP | 7.54 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 418.74 |
| LogP ≤ 5 | 7.54 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|