C26H50O3Si2 — CID 11167238
(4aR,5R,6S,8aS)-6-[tert-butyl(dimethyl)silyl]oxy-5-[[tert-butyl(dimethyl)silyl]oxymethyl]-5,8a-dimethyl-3,4,4a,6,7,8-hexahydronaphthalene-1-carbaldehyde (PubChem CID 11167238) has the molecular formula C26H50O3Si2 and a molecular weight of 466.86 g/mol. Its IUPAC name is (4aR,5R,6S,8aS)-6-[tert-butyl(dimethyl)silyl]oxy-5-[[tert-butyl(dimethyl)silyl]oxymethyl]-5,8a-dimethyl-3,4,4a,6,7,8-hexahydronaphthalene-1-carbaldehyde.
| Compound Name | (4aR,5R,6S,8aS)-6-[tert-butyl(dimethyl)silyl]oxy-5-[[tert-butyl(dimethyl)silyl]oxymethyl]-5,8a-dimethyl-3,4,4a,6,7,8-hexahydronaphthalene-1-carbaldehyde |
|---|---|
| PubChem CID | 11167238 |
| Molecular Formula | C26H50O3Si2 |
| Molecular Weight | 466.86 g/mol |
| Exact Mass | 466.33 |
| IUPAC Name | (4aR,5R,6S,8aS)-6-[tert-butyl(dimethyl)silyl]oxy-5-[[tert-butyl(dimethyl)silyl]oxymethyl]-5,8a-dimethyl-3,4,4a,6,7,8-hexahydronaphthalene-1-carbaldehyde |
| SMILES | CC(C)(C)[Si](C)(C)OC[C@]1(C)[C@@H](O[Si](C)(C)C(C)(C)C)CC[C@]2(C)C(C=O)=CCC[C@@H]12 |
| InChI | InChI=1S/C26H50O3Si2/c1-23(2,3)30(9,10)28-19-26(8)21-15-13-14-20(18-27)25(21,7)17-16-22(26)29-31(11,12)24(4,5)6/h14,18,21-22H,13,15-17,19H2,1-12H3/t21-,22+,25-,26+/m1/s1 |
| InChIKey | QJHDOZLIYWBKNL-GETZNYBYSA-N |
| XLogP | 7.74 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 466.86 |
| LogP ≤ 5 | 7.74 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|