C33H66O4Si3 — CID 134945193
(3S,4aR,6S,8aS)-3,6-bis[[tert-butyl(dimethyl)silyl]oxy]-5-[[tert-butyl(dimethyl)silyl]oxymethyl]-2,5,8a-trimethyl-3,4,4a,6,7,8-hexahydronaphthalene-1-carbaldehyde (PubChem CID 134945193) has the molecular formula C33H66O4Si3 and a molecular weight of 611.15 g/mol. Its IUPAC name is (3S,4aR,6S,8aS)-3,6-bis[[tert-butyl(dimethyl)silyl]oxy]-5-[[tert-butyl(dimethyl)silyl]oxymethyl]-2,5,8a-trimethyl-3,4,4a,6,7,8-hexahydronaphthalene-1-carbaldehyde.
| Compound Name | (3S,4aR,6S,8aS)-3,6-bis[[tert-butyl(dimethyl)silyl]oxy]-5-[[tert-butyl(dimethyl)silyl]oxymethyl]-2,5,8a-trimethyl-3,4,4a,6,7,8-hexahydronaphthalene-1-carbaldehyde |
|---|---|
| PubChem CID | 134945193 |
| Molecular Formula | C33H66O4Si3 |
| Molecular Weight | 611.15 g/mol |
| Exact Mass | 610.43 |
| IUPAC Name | (3S,4aR,6S,8aS)-3,6-bis[[tert-butyl(dimethyl)silyl]oxy]-5-[[tert-butyl(dimethyl)silyl]oxymethyl]-2,5,8a-trimethyl-3,4,4a,6,7,8-hexahydronaphthalene-1-carbaldehyde |
| SMILES | CC1=C(C=O)[C@@]2(C)CC[C@H](O[Si](C)(C)C(C)(C)C)C(C)(CO[Si](C)(C)C(C)(C)C)[C@@H]2C[C@@H]1O[Si](C)(C)C(C)(C)C |
| InChI | InChI=1S/C33H66O4Si3/c1-24-25(22-34)32(11)20-19-28(37-40(17,18)31(8,9)10)33(12,23-35-38(13,14)29(2,3)4)27(32)21-26(24)36-39(15,16)30(5,6)7/h22,26-28H,19-21,23H2,1-18H3/t26-,27+,28-,32+,33?/m0/s1 |
| InChIKey | JSDFMWVLFVXFSF-MUYLMLJCSA-N |
| XLogP | 10.13 |
| TPSA | 44.76 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 611.15 |
| LogP ≤ 5 | 10.13 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|