C31H58O3Si2 — CID 139193156
(1S,2S,4aR,5R,7R,8R,8aS)-5,7-bis[[tert-butyl(dimethyl)silyl]oxy]-3,4a,8-trimethyl-2-(3-methylbut-2-en-2-yl)-2,5,6,7,8,8a-hexahydro-1H-naphthalene-1-carbaldehyde (PubChem CID 139193156) has the molecular formula C31H58O3Si2 and a molecular weight of 534.97 g/mol. Its IUPAC name is (1S,2S,4aR,5R,7R,8R,8aS)-5,7-bis[[tert-butyl(dimethyl)silyl]oxy]-3,4a,8-trimethyl-2-(3-methylbut-2-en-2-yl)-2,5,6,7,8,8a-hexahydro-1H-naphthalene-1-carbaldehyde.
| Compound Name | (1S,2S,4aR,5R,7R,8R,8aS)-5,7-bis[[tert-butyl(dimethyl)silyl]oxy]-3,4a,8-trimethyl-2-(3-methylbut-2-en-2-yl)-2,5,6,7,8,8a-hexahydro-1H-naphthalene-1-carbaldehyde |
|---|---|
| PubChem CID | 139193156 |
| Molecular Formula | C31H58O3Si2 |
| Molecular Weight | 534.97 g/mol |
| Exact Mass | 534.39 |
| IUPAC Name | (1S,2S,4aR,5R,7R,8R,8aS)-5,7-bis[[tert-butyl(dimethyl)silyl]oxy]-3,4a,8-trimethyl-2-(3-methylbut-2-en-2-yl)-2,5,6,7,8,8a-hexahydro-1H-naphthalene-1-carbaldehyde |
| SMILES | CC1=C[C@@]2(C)[C@@H]([C@@H](C)[C@H](O[Si](C)(C)C(C)(C)C)C[C@H]2O[Si](C)(C)C(C)(C)C)[C@H](C=O)[C@@H]1C(C)=C(C)C |
| InChI | InChI=1S/C31H58O3Si2/c1-20(2)22(4)27-21(3)18-31(12)26(34-36(15,16)30(9,10)11)17-25(23(5)28(31)24(27)19-32)33-35(13,14)29(6,7)8/h18-19,23-28H,17H2,1-16H3/t23-,24+,25+,26+,27-,28-,31+/m0/s1 |
| InChIKey | KKAZYNOIQMBDDL-PKMBEXOKSA-N |
| XLogP | 9.18 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 534.97 |
| LogP ≤ 5 | 9.18 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|