C25H48O3Si2 — CID 135016488
(1S,4aS,6S,8aR)-6-[tert-butyl(dimethyl)silyl]oxy-1,5,5,8a-tetramethyl-2-methylidene-4a-trimethylsilyloxy-4,6,7,8-tetrahydro-3H-naphthalene-1-carbaldehyde (PubChem CID 135016488) has the molecular formula C25H48O3Si2 and a molecular weight of 452.83 g/mol. Its IUPAC name is (1S,4aS,6S,8aR)-6-[tert-butyl(dimethyl)silyl]oxy-1,5,5,8a-tetramethyl-2-methylidene-4a-trimethylsilyloxy-4,6,7,8-tetrahydro-3H-naphthalene-1-carbaldehyde.
| Compound Name | (1S,4aS,6S,8aR)-6-[tert-butyl(dimethyl)silyl]oxy-1,5,5,8a-tetramethyl-2-methylidene-4a-trimethylsilyloxy-4,6,7,8-tetrahydro-3H-naphthalene-1-carbaldehyde |
|---|---|
| PubChem CID | 135016488 |
| Molecular Formula | C25H48O3Si2 |
| Molecular Weight | 452.83 g/mol |
| Exact Mass | 452.31 |
| IUPAC Name | (1S,4aS,6S,8aR)-6-[tert-butyl(dimethyl)silyl]oxy-1,5,5,8a-tetramethyl-2-methylidene-4a-trimethylsilyloxy-4,6,7,8-tetrahydro-3H-naphthalene-1-carbaldehyde |
| SMILES | C=C1CC[C@@]2(O[Si](C)(C)C)C(C)(C)[C@@H](O[Si](C)(C)C(C)(C)C)CC[C@]2(C)[C@@]1(C)C=O |
| InChI | InChI=1S/C25H48O3Si2/c1-19-14-17-25(28-29(9,10)11)22(5,6)20(27-30(12,13)21(2,3)4)15-16-24(25,8)23(19,7)18-26/h18,20H,1,14-17H2,2-13H3/t20-,23-,24+,25+/m0/s1 |
| InChIKey | MOZBVQXVKKWTIF-MNPDLOSFSA-N |
| XLogP | 7.35 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 452.83 |
| LogP ≤ 5 | 7.35 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|