C22H40O2Si — CID 127054598
2-[(1S,4aR,6S,8aR)-6-[tert-butyl(dimethyl)silyl]oxy-5,5,8a-trimethyl-2-methylidene-3,4,4a,6,7,8-hexahydro-1H-naphthalen-1-yl]acetaldehyde (PubChem CID 127054598) has the molecular formula C22H40O2Si and a molecular weight of 364.65 g/mol. Its IUPAC name is 2-[(1S,4aR,6S,8aR)-6-[tert-butyl(dimethyl)silyl]oxy-5,5,8a-trimethyl-2-methylidene-3,4,4a,6,7,8-hexahydro-1H-naphthalen-1-yl]acetaldehyde.
| Compound Name | 2-[(1S,4aR,6S,8aR)-6-[tert-butyl(dimethyl)silyl]oxy-5,5,8a-trimethyl-2-methylidene-3,4,4a,6,7,8-hexahydro-1H-naphthalen-1-yl]acetaldehyde |
|---|---|
| PubChem CID | 127054598 |
| Molecular Formula | C22H40O2Si |
| Molecular Weight | 364.65 g/mol |
| Exact Mass | 364.28 |
| IUPAC Name | 2-[(1S,4aR,6S,8aR)-6-[tert-butyl(dimethyl)silyl]oxy-5,5,8a-trimethyl-2-methylidene-3,4,4a,6,7,8-hexahydro-1H-naphthalen-1-yl]acetaldehyde |
| SMILES | C=C1CC[C@H]2C(C)(C)[C@@H](O[Si](C)(C)C(C)(C)C)CC[C@]2(C)[C@H]1CC=O |
| InChI | InChI=1S/C22H40O2Si/c1-16-10-11-18-21(5,6)19(24-25(8,9)20(2,3)4)12-14-22(18,7)17(16)13-15-23/h15,17-19H,1,10-14H2,2-9H3/t17-,18-,19-,22+/m0/s1 |
| InChIKey | OJNOFMOUEYQWRS-ZVVDCOBXSA-N |
| XLogP | 6.37 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 364.65 |
| LogP ≤ 5 | 6.37 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|