C28H50O2Si — CID 146166910
1-[(3R,3aS,5aR,7S,9aS,9bS)-3a,6,6,9a-tetramethyl-7-tri(propan-2-yl)silyloxy-3,4,5,5a,7,8,9,9b-octahydrocyclopenta[a]naphthalen-3-yl]ethanone (PubChem CID 146166910) has the molecular formula C28H50O2Si and a molecular weight of 446.79 g/mol. Its IUPAC name is 1-[(3R,3aS,5aR,7S,9aS,9bS)-3a,6,6,9a-tetramethyl-7-tri(propan-2-yl)silyloxy-3,4,5,5a,7,8,9,9b-octahydrocyclopenta[a]naphthalen-3-yl]ethanone.
| Compound Name | 1-[(3R,3aS,5aR,7S,9aS,9bS)-3a,6,6,9a-tetramethyl-7-tri(propan-2-yl)silyloxy-3,4,5,5a,7,8,9,9b-octahydrocyclopenta[a]naphthalen-3-yl]ethanone |
|---|---|
| PubChem CID | 146166910 |
| Molecular Formula | C28H50O2Si |
| Molecular Weight | 446.79 g/mol |
| Exact Mass | 446.36 |
| IUPAC Name | 1-[(3R,3aS,5aR,7S,9aS,9bS)-3a,6,6,9a-tetramethyl-7-tri(propan-2-yl)silyloxy-3,4,5,5a,7,8,9,9b-octahydrocyclopenta[a]naphthalen-3-yl]ethanone |
| SMILES | CC(=O)[C@@H]1C=C[C@@H]2[C@]1(C)CC[C@H]1C(C)(C)[C@@H](O[Si](C(C)C)(C(C)C)C(C)C)CC[C@]21C |
| InChI | InChI=1S/C28H50O2Si/c1-18(2)31(19(3)4,20(5)6)30-25-15-17-28(11)23(26(25,8)9)14-16-27(10)22(21(7)29)12-13-24(27)28/h12-13,18-20,22-25H,14-17H2,1-11H3/t22-,23-,24+,25-,27+,28-/m0/s1 |
| InChIKey | AOYHMPXUNOORDS-HFELEXTESA-N |
| XLogP | 8.18 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 446.79 |
| LogP ≤ 5 | 8.18 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|