C36H62O3Si2 — CID 12020948
(4S)-4-[(1S,3R,9S,10R,13S,14S)-1,3-bis[[tert-butyl(dimethyl)silyl]oxy]-10,13-dimethyl-2,3,4,9,11,12,14,15-octahydro-1H-cyclopenta[a]phenanthren-17-yl]pentanal (PubChem CID 12020948) has the molecular formula C36H62O3Si2 and a molecular weight of 599.06 g/mol. Its IUPAC name is (4S)-4-[(1S,3R,9S,10R,13S,14S)-1,3-bis[[tert-butyl(dimethyl)silyl]oxy]-10,13-dimethyl-2,3,4,9,11,12,14,15-octahydro-1H-cyclopenta[a]phenanthren-17-yl]pentanal.
| Compound Name | (4S)-4-[(1S,3R,9S,10R,13S,14S)-1,3-bis[[tert-butyl(dimethyl)silyl]oxy]-10,13-dimethyl-2,3,4,9,11,12,14,15-octahydro-1H-cyclopenta[a]phenanthren-17-yl]pentanal |
|---|---|
| PubChem CID | 12020948 |
| Molecular Formula | C36H62O3Si2 |
| Molecular Weight | 599.06 g/mol |
| Exact Mass | 598.42 |
| IUPAC Name | (4S)-4-[(1S,3R,9S,10R,13S,14S)-1,3-bis[[tert-butyl(dimethyl)silyl]oxy]-10,13-dimethyl-2,3,4,9,11,12,14,15-octahydro-1H-cyclopenta[a]phenanthren-17-yl]pentanal |
| SMILES | C[C@@H](CCC=O)C1=CC[C@H]2C3=CC=C4C[C@@H](O[Si](C)(C)C(C)(C)C)C[C@H](O[Si](C)(C)C(C)(C)C)[C@]4(C)[C@H]3CC[C@]12C |
| InChI | InChI=1S/C36H62O3Si2/c1-25(15-14-22-37)29-18-19-30-28-17-16-26-23-27(38-40(10,11)33(2,3)4)24-32(39-41(12,13)34(5,6)7)36(26,9)31(28)20-21-35(29,30)8/h16-18,22,25,27,30-32H,14-15,19-21,23-24H2,1-13H3/t25-,27+,30-,31-,32-,35+,36-/m0/s1 |
| InChIKey | KYGVASXDLSGIEO-LWDSCMKZSA-N |
| XLogP | 10.41 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 599.06 |
| LogP ≤ 5 | 10.41 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|