C35H60O3Si2 — CID 12021167
(3S)-3-[(1S,3R,9S,10R,13S,14S)-1,3-bis[[tert-butyl(dimethyl)silyl]oxy]-10,13-dimethyl-2,3,4,9,11,12,14,15-octahydro-1H-cyclopenta[a]phenanthren-17-yl]butanal (PubChem CID 12021167) has the molecular formula C35H60O3Si2 and a molecular weight of 585.03 g/mol. Its IUPAC name is (3S)-3-[(1S,3R,9S,10R,13S,14S)-1,3-bis[[tert-butyl(dimethyl)silyl]oxy]-10,13-dimethyl-2,3,4,9,11,12,14,15-octahydro-1H-cyclopenta[a]phenanthren-17-yl]butanal.
| Compound Name | (3S)-3-[(1S,3R,9S,10R,13S,14S)-1,3-bis[[tert-butyl(dimethyl)silyl]oxy]-10,13-dimethyl-2,3,4,9,11,12,14,15-octahydro-1H-cyclopenta[a]phenanthren-17-yl]butanal |
|---|---|
| PubChem CID | 12021167 |
| Molecular Formula | C35H60O3Si2 |
| Molecular Weight | 585.03 g/mol |
| Exact Mass | 584.41 |
| IUPAC Name | (3S)-3-[(1S,3R,9S,10R,13S,14S)-1,3-bis[[tert-butyl(dimethyl)silyl]oxy]-10,13-dimethyl-2,3,4,9,11,12,14,15-octahydro-1H-cyclopenta[a]phenanthren-17-yl]butanal |
| SMILES | C[C@@H](CC=O)C1=CC[C@H]2C3=CC=C4C[C@@H](O[Si](C)(C)C(C)(C)C)C[C@H](O[Si](C)(C)C(C)(C)C)[C@]4(C)[C@H]3CC[C@]12C |
| InChI | InChI=1S/C35H60O3Si2/c1-24(19-21-36)28-16-17-29-27-15-14-25-22-26(37-39(10,11)32(2,3)4)23-31(38-40(12,13)33(5,6)7)35(25,9)30(27)18-20-34(28,29)8/h14-16,21,24,26,29-31H,17-20,22-23H2,1-13H3/t24-,26+,29-,30-,31-,34+,35-/m0/s1 |
| InChIKey | WSADXCCCVRWLJQ-GRPYREEESA-N |
| XLogP | 10.02 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 585.03 |
| LogP ≤ 5 | 10.02 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|