C26H44O3Si — CID 102130935
(1S,2S,4aR,5E,12aS)-1,4a-dimethyl-10-methylidene-2-tri(propan-2-yl)silyloxy-1,2,3,4,8,9,12,12a-octahydrobenzo[10]annulene-7,11-dione (PubChem CID 102130935) has the molecular formula C26H44O3Si and a molecular weight of 432.72 g/mol. Its IUPAC name is (1S,2S,4aR,5E,12aS)-1,4a-dimethyl-10-methylidene-2-tri(propan-2-yl)silyloxy-1,2,3,4,8,9,12,12a-octahydrobenzo[10]annulene-7,11-dione.
| Compound Name | (1S,2S,4aR,5E,12aS)-1,4a-dimethyl-10-methylidene-2-tri(propan-2-yl)silyloxy-1,2,3,4,8,9,12,12a-octahydrobenzo[10]annulene-7,11-dione |
|---|---|
| PubChem CID | 102130935 |
| Molecular Formula | C26H44O3Si |
| Molecular Weight | 432.72 g/mol |
| Exact Mass | 432.31 |
| IUPAC Name | (1S,2S,4aR,5E,12aS)-1,4a-dimethyl-10-methylidene-2-tri(propan-2-yl)silyloxy-1,2,3,4,8,9,12,12a-octahydrobenzo[10]annulene-7,11-dione |
| SMILES | C=C1CCC(=O)/C=C/[C@@]2(C)CC[C@H](O[Si](C(C)C)(C(C)C)C(C)C)[C@@H](C)[C@@H]2CC1=O |
| InChI | InChI=1S/C26H44O3Si/c1-17(2)30(18(3)4,19(5)6)29-25-13-15-26(9)14-12-22(27)11-10-20(7)24(28)16-23(26)21(25)8/h12,14,17-19,21,23,25H,7,10-11,13,15-16H2,1-6,8-9H3/b14-12+/t21-,23-,25-,26-/m0/s1 |
| InChIKey | MSQRJUPCSQKTHC-SSHXZLBNSA-N |
| XLogP | 7.03 |
| TPSA | 43.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 432.72 |
| LogP ≤ 5 | 7.03 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|