C22H36O2Si — CID 135046014
(5R)-5-[tert-butyl(dimethyl)silyl]oxy-8,8-dimethyl-1,4a,4b,5,6,7,10,10a-octahydrophenanthren-4-one (PubChem CID 135046014) has the molecular formula C22H36O2Si and a molecular weight of 360.61 g/mol. Its IUPAC name is (5R)-5-[tert-butyl(dimethyl)silyl]oxy-8,8-dimethyl-1,4a,4b,5,6,7,10,10a-octahydrophenanthren-4-one.
| Compound Name | (5R)-5-[tert-butyl(dimethyl)silyl]oxy-8,8-dimethyl-1,4a,4b,5,6,7,10,10a-octahydrophenanthren-4-one |
|---|---|
| PubChem CID | 135046014 |
| Molecular Formula | C22H36O2Si |
| Molecular Weight | 360.61 g/mol |
| Exact Mass | 360.25 |
| IUPAC Name | (5R)-5-[tert-butyl(dimethyl)silyl]oxy-8,8-dimethyl-1,4a,4b,5,6,7,10,10a-octahydrophenanthren-4-one |
| SMILES | CC1(C)CC[C@@H](O[Si](C)(C)C(C)(C)C)C2C1=CCC1CC=CC(=O)C12 |
| InChI | InChI=1S/C22H36O2Si/c1-21(2,3)25(6,7)24-18-13-14-22(4,5)16-12-11-15-9-8-10-17(23)19(15)20(16)18/h8,10,12,15,18-20H,9,11,13-14H2,1-7H3/t15?,18-,19?,20?/m1/s1 |
| InChIKey | DQOLFNYXTHWBOZ-LSVSSVTGSA-N |
| XLogP | 5.90 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 25 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 360.61 |
| LogP ≤ 5 | 5.90 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|