C24H40O2Si — CID 135045979
(5R)-5-[tert-butyl(dimethyl)silyl]oxy-2-ethyl-8,8-dimethyl-1,4a,4b,5,6,7,10,10a-octahydrophenanthren-4-one (PubChem CID 135045979) has the molecular formula C24H40O2Si and a molecular weight of 388.67 g/mol. Its IUPAC name is (5R)-5-[tert-butyl(dimethyl)silyl]oxy-2-ethyl-8,8-dimethyl-1,4a,4b,5,6,7,10,10a-octahydrophenanthren-4-one.
| Compound Name | (5R)-5-[tert-butyl(dimethyl)silyl]oxy-2-ethyl-8,8-dimethyl-1,4a,4b,5,6,7,10,10a-octahydrophenanthren-4-one |
|---|---|
| PubChem CID | 135045979 |
| Molecular Formula | C24H40O2Si |
| Molecular Weight | 388.67 g/mol |
| Exact Mass | 388.28 |
| IUPAC Name | (5R)-5-[tert-butyl(dimethyl)silyl]oxy-2-ethyl-8,8-dimethyl-1,4a,4b,5,6,7,10,10a-octahydrophenanthren-4-one |
| SMILES | CCC1=CC(=O)C2C(CC=C3C2[C@H](O[Si](C)(C)C(C)(C)C)CCC3(C)C)C1 |
| InChI | InChI=1S/C24H40O2Si/c1-9-16-14-17-10-11-18-22(21(17)19(25)15-16)20(12-13-24(18,5)6)26-27(7,8)23(2,3)4/h11,15,17,20-22H,9-10,12-14H2,1-8H3/t17?,20-,21?,22?/m1/s1 |
| InChIKey | VYSYCGOSUHMXGL-BEEUSASCSA-N |
| XLogP | 6.68 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 388.67 |
| LogP ≤ 5 | 6.68 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|