C25H40O3Si — CID 11223795
(4aR,4bS,8aR,10aR)-10a-acetyl-7-[tert-butyl(dimethyl)silyl]oxy-2,4b,8-trimethyl-4a,5,6,8a,9,10-hexahydro-4H-phenanthren-1-one (PubChem CID 11223795) has the molecular formula C25H40O3Si and a molecular weight of 416.68 g/mol. Its IUPAC name is (4aR,4bS,8aR,10aR)-10a-acetyl-7-[tert-butyl(dimethyl)silyl]oxy-2,4b,8-trimethyl-4a,5,6,8a,9,10-hexahydro-4H-phenanthren-1-one.
| Compound Name | (4aR,4bS,8aR,10aR)-10a-acetyl-7-[tert-butyl(dimethyl)silyl]oxy-2,4b,8-trimethyl-4a,5,6,8a,9,10-hexahydro-4H-phenanthren-1-one |
|---|---|
| PubChem CID | 11223795 |
| Molecular Formula | C25H40O3Si |
| Molecular Weight | 416.68 g/mol |
| Exact Mass | 416.27 |
| IUPAC Name | (4aR,4bS,8aR,10aR)-10a-acetyl-7-[tert-butyl(dimethyl)silyl]oxy-2,4b,8-trimethyl-4a,5,6,8a,9,10-hexahydro-4H-phenanthren-1-one |
| SMILES | CC(=O)[C@@]12CC[C@H]3C(C)=C(O[Si](C)(C)C(C)(C)C)CC[C@]3(C)[C@H]1CC=C(C)C2=O |
| InChI | InChI=1S/C25H40O3Si/c1-16-10-11-21-24(7)14-13-20(28-29(8,9)23(4,5)6)17(2)19(24)12-15-25(21,18(3)26)22(16)27/h10,19,21H,11-15H2,1-9H3/t19-,21+,24-,25-/m0/s1 |
| InChIKey | UVNYOVZVRUFAAC-GAGAFAOGSA-N |
| XLogP | 6.60 |
| TPSA | 43.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 416.68 |
| LogP ≤ 5 | 6.60 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|