C17H30O2Si — CID 44632082
(3R,4aS,8aR)-6-[tert-butyl(dimethyl)silyl]oxy-3-methyl-3,4,4a,5,8,8a-hexahydro-2H-naphthalen-1-one (PubChem CID 44632082) has the molecular formula C17H30O2Si and a molecular weight of 294.51 g/mol. Its IUPAC name is (3R,4aS,8aR)-6-[tert-butyl(dimethyl)silyl]oxy-3-methyl-3,4,4a,5,8,8a-hexahydro-2H-naphthalen-1-one.
| Compound Name | (3R,4aS,8aR)-6-[tert-butyl(dimethyl)silyl]oxy-3-methyl-3,4,4a,5,8,8a-hexahydro-2H-naphthalen-1-one |
|---|---|
| PubChem CID | 44632082 |
| Molecular Formula | C17H30O2Si |
| Molecular Weight | 294.51 g/mol |
| Exact Mass | 294.20 |
| IUPAC Name | (3R,4aS,8aR)-6-[tert-butyl(dimethyl)silyl]oxy-3-methyl-3,4,4a,5,8,8a-hexahydro-2H-naphthalen-1-one |
| SMILES | C[C@H]1CC(=O)[C@@H]2CC=C(O[Si](C)(C)C(C)(C)C)C[C@@H]2C1 |
| InChI | InChI=1S/C17H30O2Si/c1-12-9-13-11-14(7-8-15(13)16(18)10-12)19-20(5,6)17(2,3)4/h7,12-13,15H,8-11H2,1-6H3/t12-,13+,15-/m1/s1 |
| InChIKey | DQDKTXUHJLVULB-VNHYZAJKSA-N |
| XLogP | 4.92 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 294.51 |
| LogP ≤ 5 | 4.92 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|