C26H42O2Si — CID 53348341
(1S,8R,9S,11S,12R,15R,16R)-11-[tert-butyl(dimethyl)silyl]oxy-1,5,9,16-tetramethyltetracyclo[6.6.2.04,15.012,16]hexadeca-3,5-dien-14-one (PubChem CID 53348341) has the molecular formula C26H42O2Si and a molecular weight of 414.71 g/mol. Its IUPAC name is (1S,8R,9S,11S,12R,15R,16R)-11-[tert-butyl(dimethyl)silyl]oxy-1,5,9,16-tetramethyltetracyclo[6.6.2.04,15.012,16]hexadeca-3,5-dien-14-one.
| Compound Name | (1S,8R,9S,11S,12R,15R,16R)-11-[tert-butyl(dimethyl)silyl]oxy-1,5,9,16-tetramethyltetracyclo[6.6.2.04,15.012,16]hexadeca-3,5-dien-14-one |
|---|---|
| PubChem CID | 53348341 |
| Molecular Formula | C26H42O2Si |
| Molecular Weight | 414.71 g/mol |
| Exact Mass | 414.30 |
| IUPAC Name | (1S,8R,9S,11S,12R,15R,16R)-11-[tert-butyl(dimethyl)silyl]oxy-1,5,9,16-tetramethyltetracyclo[6.6.2.04,15.012,16]hexadeca-3,5-dien-14-one |
| SMILES | CC1=CC[C@@H]2[C@@H](C)C[C@H](O[Si](C)(C)C(C)(C)C)[C@@H]3CC(=O)[C@@]4(C)CC=C1[C@H]4[C@@]23C |
| InChI | InChI=1S/C26H42O2Si/c1-16-10-11-19-17(2)14-21(28-29(8,9)24(3,4)5)20-15-22(27)25(6)13-12-18(16)23(25)26(19,20)7/h10,12,17,19-21,23H,11,13-15H2,1-9H3/t17-,19+,20-,21-,23+,25+,26-/m0/s1 |
| InChIKey | HVOLQJPTAGHUPF-ROECFGHSSA-N |
| XLogP | 6.93 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 414.71 |
| LogP ≤ 5 | 6.93 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|