C27H44O3Si — CID 134848607
(3S,8S,9S,12R)-3-[3-[tert-butyl(dimethyl)silyl]oxypropyl]-1,9,12-trimethyl-4-prop-2-enoyltricyclo[6.3.1.03,9]dodec-4-en-2-one (PubChem CID 134848607) has the molecular formula C27H44O3Si and a molecular weight of 444.73 g/mol. Its IUPAC name is (3S,8S,9S,12R)-3-[3-[tert-butyl(dimethyl)silyl]oxypropyl]-1,9,12-trimethyl-4-prop-2-enoyltricyclo[6.3.1.03,9]dodec-4-en-2-one.
| Compound Name | (3S,8S,9S,12R)-3-[3-[tert-butyl(dimethyl)silyl]oxypropyl]-1,9,12-trimethyl-4-prop-2-enoyltricyclo[6.3.1.03,9]dodec-4-en-2-one |
|---|---|
| PubChem CID | 134848607 |
| Molecular Formula | C27H44O3Si |
| Molecular Weight | 444.73 g/mol |
| Exact Mass | 444.31 |
| IUPAC Name | (3S,8S,9S,12R)-3-[3-[tert-butyl(dimethyl)silyl]oxypropyl]-1,9,12-trimethyl-4-prop-2-enoyltricyclo[6.3.1.03,9]dodec-4-en-2-one |
| SMILES | C=CC(=O)C1=CCC[C@H]2[C@@H](C)C3(C)CC[C@]2(C)[C@]1(CCCO[Si](C)(C)C(C)(C)C)C3=O |
| InChI | InChI=1S/C27H44O3Si/c1-10-22(28)21-14-11-13-20-19(2)25(6)16-17-26(20,7)27(21,23(25)29)15-12-18-30-31(8,9)24(3,4)5/h10,14,19-20H,1,11-13,15-18H2,2-9H3/t19-,20+,25?,26+,27+/m1/s1 |
| InChIKey | AKYZMPZNDQKUHN-KXQNSYOFSA-N |
| XLogP | 6.89 |
| TPSA | 43.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 444.73 |
| LogP ≤ 5 | 6.89 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|