C16H22O2Si — CID 134899107
(4aS,8aR,9aR)-3-trimethylsilyl-4,4a,5,8a,9,9a-hexahydro-1H-cyclopenta[b]naphthalene-2,6-dione (PubChem CID 134899107) has the molecular formula C16H22O2Si and a molecular weight of 274.44 g/mol. Its IUPAC name is (4aS,8aR,9aR)-3-trimethylsilyl-4,4a,5,8a,9,9a-hexahydro-1H-cyclopenta[b]naphthalene-2,6-dione.
| Compound Name | (4aS,8aR,9aR)-3-trimethylsilyl-4,4a,5,8a,9,9a-hexahydro-1H-cyclopenta[b]naphthalene-2,6-dione |
|---|---|
| PubChem CID | 134899107 |
| Molecular Formula | C16H22O2Si |
| Molecular Weight | 274.44 g/mol |
| Exact Mass | 274.14 |
| IUPAC Name | (4aS,8aR,9aR)-3-trimethylsilyl-4,4a,5,8a,9,9a-hexahydro-1H-cyclopenta[b]naphthalene-2,6-dione |
| SMILES | C[Si](C)(C)C1=C2C[C@H]3CC(=O)C=C[C@@H]3C[C@@H]2CC1=O |
| InChI | InChI=1S/C16H22O2Si/c1-19(2,3)16-14-8-11-7-13(17)5-4-10(11)6-12(14)9-15(16)18/h4-5,10-12H,6-9H2,1-3H3/t10-,11-,12-/m1/s1 |
| InChIKey | ZSXXHTPYRRMUPJ-IJLUTSLNSA-N |
| XLogP | 3.30 |
| TPSA | 34.14 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 274.44 |
| LogP ≤ 5 | 3.30 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|