C11H20OSi — CID 10856412
(4S,6S)-4-methyl-6-trimethylsilylcyclohept-2-en-1-one (PubChem CID 10856412) has the molecular formula C11H20OSi and a molecular weight of 196.37 g/mol. Its IUPAC name is (4S,6S)-4-methyl-6-trimethylsilylcyclohept-2-en-1-one.
| Compound Name | (4S,6S)-4-methyl-6-trimethylsilylcyclohept-2-en-1-one |
|---|---|
| PubChem CID | 10856412 |
| Molecular Formula | C11H20OSi |
| Molecular Weight | 196.37 g/mol |
| Exact Mass | 196.13 |
| IUPAC Name | (4S,6S)-4-methyl-6-trimethylsilylcyclohept-2-en-1-one |
| SMILES | C[C@@H]1C=CC(=O)C[C@@H]([Si](C)(C)C)C1 |
| InChI | InChI=1S/C11H20OSi/c1-9-5-6-10(12)8-11(7-9)13(2,3)4/h5-6,9,11H,7-8H2,1-4H3/t9-,11+/m1/s1 |
| InChIKey | KEPBLTDVPKUWPP-KOLCDFICSA-N |
| XLogP | 3.25 |
| TPSA | 17.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 196.37 |
| LogP ≤ 5 | 3.25 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|