C11H14O — CID 19835402
6-methyl-4,4a,5,6-tetrahydro-3H-naphthalen-2-one (PubChem CID 19835402) has the molecular formula C11H14O and a molecular weight of 162.23 g/mol. Its IUPAC name is 6-methyl-4,4a,5,6-tetrahydro-3H-naphthalen-2-one.
| Compound Name | 6-methyl-4,4a,5,6-tetrahydro-3H-naphthalen-2-one |
|---|---|
| PubChem CID | 19835402 |
| Molecular Formula | C11H14O |
| Molecular Weight | 162.23 g/mol |
| Exact Mass | 162.10 |
| IUPAC Name | 6-methyl-4,4a,5,6-tetrahydro-3H-naphthalen-2-one |
| SMILES | CC1C=CC2=CC(=O)CCC2C1 |
| InChI | InChI=1S/C11H14O/c1-8-2-3-10-7-11(12)5-4-9(10)6-8/h2-3,7-9H,4-6H2,1H3 |
| InChIKey | BNRMWBVMJULGFI-UHFFFAOYSA-N |
| XLogP | 2.49 |
| TPSA | 17.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 162.23 |
| LogP ≤ 5 | 2.49 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |