C14H18O3 — CID 163867870
(1R,3aR,9aS)-1,9a-dimethyl-3a,4,7,8,8a,9-hexahydro-1H-benzo[f][2]benzofuran-3,6-dione (PubChem CID 163867870) has the molecular formula C14H18O3 and a molecular weight of 234.29 g/mol. Its IUPAC name is (1R,3aR,9aS)-1,9a-dimethyl-3a,4,7,8,8a,9-hexahydro-1H-benzo[f][2]benzofuran-3,6-dione.
| Compound Name | (1R,3aR,9aS)-1,9a-dimethyl-3a,4,7,8,8a,9-hexahydro-1H-benzo[f][2]benzofuran-3,6-dione |
|---|---|
| PubChem CID | 163867870 |
| Molecular Formula | C14H18O3 |
| Molecular Weight | 234.29 g/mol |
| Exact Mass | 234.13 |
| IUPAC Name | (1R,3aR,9aS)-1,9a-dimethyl-3a,4,7,8,8a,9-hexahydro-1H-benzo[f][2]benzofuran-3,6-dione |
| SMILES | C[C@H]1OC(=O)[C@@H]2CC3=CC(=O)CCC3C[C@]12C |
| InChI | InChI=1S/C14H18O3/c1-8-14(2)7-9-3-4-11(15)5-10(9)6-12(14)13(16)17-8/h5,8-9,12H,3-4,6-7H2,1-2H3/t8-,9?,12+,14-/m1/s1 |
| InChIKey | PIFMFDWGVFYVLU-UCKMJSPMSA-N |
| XLogP | 2.25 |
| TPSA | 43.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 234.29 |
| LogP ≤ 5 | 2.25 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |