C16H27NO — CID 129391048
(4aR,7R)-7-(dipropylamino)-4,4a,5,6,7,8-hexahydro-3H-naphthalen-2-one (PubChem CID 129391048) has the molecular formula C16H27NO and a molecular weight of 249.40 g/mol. Its IUPAC name is (4aR,7R)-7-(dipropylamino)-4,4a,5,6,7,8-hexahydro-3H-naphthalen-2-one.
| Compound Name | (4aR,7R)-7-(dipropylamino)-4,4a,5,6,7,8-hexahydro-3H-naphthalen-2-one |
|---|---|
| PubChem CID | 129391048 |
| Molecular Formula | C16H27NO |
| Molecular Weight | 249.40 g/mol |
| Exact Mass | 249.21 |
| IUPAC Name | (4aR,7R)-7-(dipropylamino)-4,4a,5,6,7,8-hexahydro-3H-naphthalen-2-one |
| SMILES | CCCN(CCC)[C@@H]1CC[C@@H]2CCC(=O)C=C2C1 |
| InChI | InChI=1S/C16H27NO/c1-3-9-17(10-4-2)15-7-5-13-6-8-16(18)12-14(13)11-15/h12-13,15H,3-11H2,1-2H3/t13-,15-/m1/s1 |
| InChIKey | YXFJYFPPJUQSJF-UKRRQHHQSA-N |
| XLogP | 3.57 |
| TPSA | 20.31 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 249.40 |
| LogP ≤ 5 | 3.57 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |