C16H27N — CID 57305707
N,N-dipropyl-1,2,3,4,6,7-hexahydronaphthalen-2-amine (PubChem CID 57305707) has the molecular formula C16H27N and a molecular weight of 233.40 g/mol. Its IUPAC name is N,N-dipropyl-1,2,3,4,6,7-hexahydronaphthalen-2-amine.
| Compound Name | N,N-dipropyl-1,2,3,4,6,7-hexahydronaphthalen-2-amine |
|---|---|
| PubChem CID | 57305707 |
| Molecular Formula | C16H27N |
| Molecular Weight | 233.40 g/mol |
| Exact Mass | 233.21 |
| IUPAC Name | N,N-dipropyl-1,2,3,4,6,7-hexahydronaphthalen-2-amine |
| SMILES | CCCN(CCC)C1CCC2=CCCC=C2C1 |
| InChI | InChI=1S/C16H27N/c1-3-11-17(12-4-2)16-10-9-14-7-5-6-8-15(14)13-16/h7-8,16H,3-6,9-13H2,1-2H3 |
| InChIKey | DPFDVOQXZVZUGB-UHFFFAOYSA-N |
| XLogP | 4.31 |
| TPSA | 3.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 233.40 |
| LogP ≤ 5 | 4.31 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |