C16H28Cl2N2 — CID 18650733
(6R)-6-N,6-N-dipropyl-5,6,7,8-tetrahydronaphthalene-1,6-diamine;dihydrochloride (PubChem CID 18650733) has the molecular formula C16H28Cl2N2 and a molecular weight of 319.32 g/mol. Its IUPAC name is (6R)-6-N,6-N-dipropyl-5,6,7,8-tetrahydronaphthalene-1,6-diamine;dihydrochloride.
| Compound Name | (6R)-6-N,6-N-dipropyl-5,6,7,8-tetrahydronaphthalene-1,6-diamine;dihydrochloride |
|---|---|
| PubChem CID | 18650733 |
| Molecular Formula | C16H28Cl2N2 |
| Molecular Weight | 319.32 g/mol |
| Exact Mass | 318.16 |
| IUPAC Name | (6R)-6-N,6-N-dipropyl-5,6,7,8-tetrahydronaphthalene-1,6-diamine;dihydrochloride |
| SMILES | CCCN(CCC)[C@@H]1CCc2c(N)cccc2C1.Cl.Cl |
| InChI | InChI=1S/C16H26N2.2ClH/c1-3-10-18(11-4-2)14-8-9-15-13(12-14)6-5-7-16(15)17;;/h5-7,14H,3-4,8-12,17H2,1-2H3;2*1H/t14-;;/m1../s1 |
| InChIKey | AVRLOOODTVYLJU-FMOMHUKBSA-N |
| XLogP | 4.09 |
| TPSA | 29.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 319.32 |
| LogP ≤ 5 | 4.09 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|