C19H26N2S — CID 67251343
7-N-propyl-7-N-(2-thiophen-3-ylethyl)-5,6,7,8-tetrahydronaphthalene-1,7-diamine (PubChem CID 67251343) has the molecular formula C19H26N2S and a molecular weight of 314.50 g/mol. Its IUPAC name is 7-N-propyl-7-N-(2-thiophen-3-ylethyl)-5,6,7,8-tetrahydronaphthalene-1,7-diamine.
| Compound Name | 7-N-propyl-7-N-(2-thiophen-3-ylethyl)-5,6,7,8-tetrahydronaphthalene-1,7-diamine |
|---|---|
| PubChem CID | 67251343 |
| Molecular Formula | C19H26N2S |
| Molecular Weight | 314.50 g/mol |
| Exact Mass | 314.18 |
| IUPAC Name | 7-N-propyl-7-N-(2-thiophen-3-ylethyl)-5,6,7,8-tetrahydronaphthalene-1,7-diamine |
| SMILES | CCCN(CCc1ccsc1)C1CCc2cccc(N)c2C1 |
| InChI | InChI=1S/C19H26N2S/c1-2-10-21(11-8-15-9-12-22-14-15)17-7-6-16-4-3-5-19(20)18(16)13-17/h3-5,9,12,14,17H,2,6-8,10-11,13,20H2,1H3 |
| InChIKey | DZOXZSHAHFTTQX-UHFFFAOYSA-N |
| XLogP | 4.14 |
| TPSA | 29.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 314.50 |
| LogP ≤ 5 | 4.14 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|