C16H26N2 — CID 14835953
4-methyl-N,N-dipropyl-5,6,7,8-tetrahydroquinolin-7-amine (PubChem CID 14835953) has the molecular formula C16H26N2 and a molecular weight of 246.40 g/mol. Its IUPAC name is 4-methyl-N,N-dipropyl-5,6,7,8-tetrahydroquinolin-7-amine.
| Compound Name | 4-methyl-N,N-dipropyl-5,6,7,8-tetrahydroquinolin-7-amine |
|---|---|
| PubChem CID | 14835953 |
| Molecular Formula | C16H26N2 |
| Molecular Weight | 246.40 g/mol |
| Exact Mass | 246.21 |
| IUPAC Name | 4-methyl-N,N-dipropyl-5,6,7,8-tetrahydroquinolin-7-amine |
| SMILES | CCCN(CCC)C1CCc2c(C)ccnc2C1 |
| InChI | InChI=1S/C16H26N2/c1-4-10-18(11-5-2)14-6-7-15-13(3)8-9-17-16(15)12-14/h8-9,14H,4-7,10-12H2,1-3H3 |
| InChIKey | NTCXZWXWETZTKK-UHFFFAOYSA-N |
| XLogP | 3.37 |
| TPSA | 16.13 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 246.40 |
| LogP ≤ 5 | 3.37 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |