C19H26N2O — CID 19041549
7-(dipropylamino)-6,7,8,9-tetrahydro-1H-benzo[g]indole-3-carbaldehyde (PubChem CID 19041549) has the molecular formula C19H26N2O and a molecular weight of 298.43 g/mol. Its IUPAC name is 7-(dipropylamino)-6,7,8,9-tetrahydro-1H-benzo[g]indole-3-carbaldehyde.
| Compound Name | 7-(dipropylamino)-6,7,8,9-tetrahydro-1H-benzo[g]indole-3-carbaldehyde |
|---|---|
| PubChem CID | 19041549 |
| Molecular Formula | C19H26N2O |
| Molecular Weight | 298.43 g/mol |
| Exact Mass | 298.20 |
| IUPAC Name | 7-(dipropylamino)-6,7,8,9-tetrahydro-1H-benzo[g]indole-3-carbaldehyde |
| SMILES | CCCN(CCC)C1CCc2c(ccc3c(C=O)c[nH]c23)C1 |
| InChI | InChI=1S/C19H26N2O/c1-3-9-21(10-4-2)16-6-8-17-14(11-16)5-7-18-15(13-22)12-20-19(17)18/h5,7,12-13,16,20H,3-4,6,8-11H2,1-2H3 |
| InChIKey | CZSNLSBTKWNIOK-UHFFFAOYSA-N |
| XLogP | 3.96 |
| TPSA | 36.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 298.43 |
| LogP ≤ 5 | 3.96 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|