C17H26N2O3 — CID 13186869
6-methoxy-5-nitro-N,N-dipropyl-1,2,3,4-tetrahydronaphthalen-2-amine (PubChem CID 13186869) has the molecular formula C17H26N2O3 and a molecular weight of 306.41 g/mol. Its IUPAC name is 6-methoxy-5-nitro-N,N-dipropyl-1,2,3,4-tetrahydronaphthalen-2-amine.
| Compound Name | 6-methoxy-5-nitro-N,N-dipropyl-1,2,3,4-tetrahydronaphthalen-2-amine |
|---|---|
| PubChem CID | 13186869 |
| Molecular Formula | C17H26N2O3 |
| Molecular Weight | 306.41 g/mol |
| Exact Mass | 306.19 |
| IUPAC Name | 6-methoxy-5-nitro-N,N-dipropyl-1,2,3,4-tetrahydronaphthalen-2-amine |
| SMILES | CCCN(CCC)C1CCc2c(ccc(OC)c2[N+](=O)[O-])C1 |
| InChI | InChI=1S/C17H26N2O3/c1-4-10-18(11-5-2)14-7-8-15-13(12-14)6-9-16(22-3)17(15)19(20)21/h6,9,14H,4-5,7-8,10-12H2,1-3H3 |
| InChIKey | AHRILNKKNKMZOM-UHFFFAOYSA-N |
| XLogP | 3.58 |
| TPSA | 55.61 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 306.41 |
| LogP ≤ 5 | 3.58 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|