C16H23ClN2O2 — CID 19032654
8-chloro-7-nitro-N,N-dipropyl-1,2,3,4-tetrahydronaphthalen-2-amine (PubChem CID 19032654) has the molecular formula C16H23ClN2O2 and a molecular weight of 310.82 g/mol. Its IUPAC name is 8-chloro-7-nitro-N,N-dipropyl-1,2,3,4-tetrahydronaphthalen-2-amine.
| Compound Name | 8-chloro-7-nitro-N,N-dipropyl-1,2,3,4-tetrahydronaphthalen-2-amine |
|---|---|
| PubChem CID | 19032654 |
| Molecular Formula | C16H23ClN2O2 |
| Molecular Weight | 310.82 g/mol |
| Exact Mass | 310.14 |
| IUPAC Name | 8-chloro-7-nitro-N,N-dipropyl-1,2,3,4-tetrahydronaphthalen-2-amine |
| SMILES | CCCN(CCC)C1CCc2ccc([N+](=O)[O-])c(Cl)c2C1 |
| InChI | InChI=1S/C16H23ClN2O2/c1-3-9-18(10-4-2)13-7-5-12-6-8-15(19(20)21)16(17)14(12)11-13/h6,8,13H,3-5,7,9-11H2,1-2H3 |
| InChIKey | SRCPPUNBNAVGLX-UHFFFAOYSA-N |
| XLogP | 4.23 |
| TPSA | 46.38 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 310.82 |
| LogP ≤ 5 | 4.23 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|