C18H24N2O — CID 10613080
(4R)-4-(dipropylamino)-1,3,4,5-tetrahydrobenzo[cd]indole-6-carbaldehyde (PubChem CID 10613080) has the molecular formula C18H24N2O and a molecular weight of 284.40 g/mol. Its IUPAC name is (4R)-4-(dipropylamino)-1,3,4,5-tetrahydrobenzo[cd]indole-6-carbaldehyde.
| Compound Name | (4R)-4-(dipropylamino)-1,3,4,5-tetrahydrobenzo[cd]indole-6-carbaldehyde |
|---|---|
| PubChem CID | 10613080 |
| Molecular Formula | C18H24N2O |
| Molecular Weight | 284.40 g/mol |
| Exact Mass | 284.19 |
| IUPAC Name | (4R)-4-(dipropylamino)-1,3,4,5-tetrahydrobenzo[cd]indole-6-carbaldehyde |
| SMILES | CCCN(CCC)[C@H]1Cc2c[nH]c3ccc(C=O)c(c23)C1 |
| InChI | InChI=1S/C18H24N2O/c1-3-7-20(8-4-2)15-9-14-11-19-17-6-5-13(12-21)16(10-15)18(14)17/h5-6,11-12,15,19H,3-4,7-10H2,1-2H3/t15-/m0/s1 |
| InChIKey | BYRKFQUXPHGAKS-HNNXBMFYSA-N |
| XLogP | 3.57 |
| TPSA | 36.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 284.40 |
| LogP ≤ 5 | 3.57 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|