C18H24N2OS — CID 23358090
4-(dipropylamino)-1,3,4,5-tetrahydrobenzo[cd]indole-6-carbothioic S-acid (PubChem CID 23358090) has the molecular formula C18H24N2OS and a molecular weight of 316.47 g/mol. Its IUPAC name is 4-(dipropylamino)-1,3,4,5-tetrahydrobenzo[cd]indole-6-carbothioic S-acid.
| Compound Name | 4-(dipropylamino)-1,3,4,5-tetrahydrobenzo[cd]indole-6-carbothioic S-acid |
|---|---|
| PubChem CID | 23358090 |
| Molecular Formula | C18H24N2OS |
| Molecular Weight | 316.47 g/mol |
| Exact Mass | 316.16 |
| IUPAC Name | 4-(dipropylamino)-1,3,4,5-tetrahydrobenzo[cd]indole-6-carbothioic S-acid |
| SMILES | CCCN(CCC)C1Cc2c[nH]c3ccc(C(=O)S)c(c23)C1 |
| InChI | InChI=1S/C18H24N2OS/c1-3-7-20(8-4-2)13-9-12-11-19-16-6-5-14(18(21)22)15(10-13)17(12)16/h5-6,11,13,19H,3-4,7-10H2,1-2H3,(H,21,22) |
| InChIKey | ZOLIWFQKIVJKOK-UHFFFAOYSA-N |
| XLogP | 3.83 |
| TPSA | 36.10 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 316.47 |
| LogP ≤ 5 | 3.83 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'thioester', 'substructure': 'N/A'}, {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|