C16H20N2OS — CID 23358087
4-[methyl(propan-2-yl)amino]-1,3,4,5-tetrahydrobenzo[cd]indole-6-carbothioic S-acid (PubChem CID 23358087) has the molecular formula C16H20N2OS and a molecular weight of 288.42 g/mol. Its IUPAC name is 4-[methyl(propan-2-yl)amino]-1,3,4,5-tetrahydrobenzo[cd]indole-6-carbothioic S-acid.
| Compound Name | 4-[methyl(propan-2-yl)amino]-1,3,4,5-tetrahydrobenzo[cd]indole-6-carbothioic S-acid |
|---|---|
| PubChem CID | 23358087 |
| Molecular Formula | C16H20N2OS |
| Molecular Weight | 288.42 g/mol |
| Exact Mass | 288.13 |
| IUPAC Name | 4-[methyl(propan-2-yl)amino]-1,3,4,5-tetrahydrobenzo[cd]indole-6-carbothioic S-acid |
| SMILES | CC(C)N(C)C1Cc2c[nH]c3ccc(C(=O)S)c(c23)C1 |
| InChI | InChI=1S/C16H20N2OS/c1-9(2)18(3)11-6-10-8-17-14-5-4-12(16(19)20)13(7-11)15(10)14/h4-5,8-9,11,17H,6-7H2,1-3H3,(H,19,20) |
| InChIKey | QRZRBAPBAIQPEA-UHFFFAOYSA-N |
| XLogP | 3.05 |
| TPSA | 36.10 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 288.42 |
| LogP ≤ 5 | 3.05 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'thioester', 'substructure': 'N/A'}, {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|