C15H18N2OS — CID 23358119
4-(propylamino)-1,3,4,5-tetrahydrobenzo[cd]indole-6-carbothioic S-acid (PubChem CID 23358119) has the molecular formula C15H18N2OS and a molecular weight of 274.39 g/mol. Its IUPAC name is 4-(propylamino)-1,3,4,5-tetrahydrobenzo[cd]indole-6-carbothioic S-acid.
| Compound Name | 4-(propylamino)-1,3,4,5-tetrahydrobenzo[cd]indole-6-carbothioic S-acid |
|---|---|
| PubChem CID | 23358119 |
| Molecular Formula | C15H18N2OS |
| Molecular Weight | 274.39 g/mol |
| Exact Mass | 274.11 |
| IUPAC Name | 4-(propylamino)-1,3,4,5-tetrahydrobenzo[cd]indole-6-carbothioic S-acid |
| SMILES | CCCNC1Cc2c[nH]c3ccc(C(=O)S)c(c23)C1 |
| InChI | InChI=1S/C15H18N2OS/c1-2-5-16-10-6-9-8-17-13-4-3-11(15(18)19)12(7-10)14(9)13/h3-4,8,10,16-17H,2,5-7H2,1H3,(H,18,19) |
| InChIKey | QPZCBXWUQULXGR-UHFFFAOYSA-N |
| XLogP | 2.70 |
| TPSA | 44.89 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 274.39 |
| LogP ≤ 5 | 2.70 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'thioester', 'substructure': 'N/A'}, {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|